About 1-(7-cyano-4-methyl-2,3-dihydro-1H-quinoxalin-6-yl)piperidine-4-carboxamide
1-(7-cyano-4-methyl-2,3-dihydro-1H-quinoxalin-6-yl)piperidine-4-carboxamide (PubChem CID 162754024) has the molecular formula C16H21N5O
and a molecular weight of 299.38 g/mol. Its IUPAC name is 1-(7-cyano-4-methyl-2,3-dihydro-1H-quinoxalin-6-yl)piperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-(7-cyano-4-methyl-2,3-dihydro-1H-quinoxalin-6-yl)piperidine-4-carboxamide |
| PubChem CID | 162754024 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 1-(7-cyano-4-methyl-2,3-dihydro-1H-quinoxalin-6-yl)piperidine-4-carboxamide |
| SMILES | CN1CCNc2cc(C#N)c(N3CCC(C(N)=O)CC3)cc21 |
| InChI | InChI=1S/C16H21N5O/c1-20-7-4-19-13-8-12(10-17)14(9-15(13)20)21-5-2-11(3-6-21)16(18)22/h8-9,11,19H,2-7H2,1H3,(H2,18,22) |
| InChIKey | ULBCYEGIDWKFEN-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 85.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(7-cyano-4-methyl-2,3-dihydro-1H-quinoxalin-6-yl)piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-cyano-4-methyl-2,3-dihydro-1H-quinoxalin-6-yl)piperidine-4-carboxamide?
The IUPAC name of 1-(7-cyano-4-methyl-2,3-dihydro-1H-quinoxalin-6-yl)piperidine-4-carboxamide (CID 162754024) is 1-(7-cyano-4-methyl-2,3-dihydro-1H-quinoxalin-6-yl)piperidine-4-carboxamide.
What is the SMILES notation for 1-(7-cyano-4-methyl-2,3-dihydro-1H-quinoxalin-6-yl)piperidine-4-carboxamide?
The canonical SMILES for 1-(7-cyano-4-methyl-2,3-dihydro-1H-quinoxalin-6-yl)piperidine-4-carboxamide is CN1CCNc2cc(C#N)c(N3CCC(C(N)=O)CC3)cc21.
What is the InChIKey of 1-(7-cyano-4-methyl-2,3-dihydro-1H-quinoxalin-6-yl)piperidine-4-carboxamide?
The InChIKey is ULBCYEGIDWKFEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N5O/c1-20-7-4-19-13-8-12(10-17)14(9-15(13)20)21-5-2-11(3-6-21)16(18)22/h8-9,11,19H,2-7H2,1H3,(H2,18,22).
What are the key properties of 1-(7-cyano-4-methyl-2,3-dihydro-1H-quinoxalin-6-yl)piperidine-4-carboxamide?
1-(7-cyano-4-methyl-2,3-dihydro-1H-quinoxalin-6-yl)piperidine-4-carboxamide has a molecular weight of 299.38 g/mol, XLogP of 1.12, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-cyano-4-methyl-2,3-dihydro-1H-quinoxalin-6-yl)piperidine-4-carboxamide is sourced from PubChem (CID 162754024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).