About N-(2-hydroxyethyl)-5,6-dimethylpyrido[4,3-b]carbazole-9-carboxamide
N-(2-hydroxyethyl)-5,6-dimethylpyrido[4,3-b]carbazole-9-carboxamide (PubChem CID 162755179) has the molecular formula C20H19N3O2
and a molecular weight of 333.39 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-5,6-dimethylpyrido[4,3-b]carbazole-9-carboxamide.
Molecular Properties
| Compound Name | N-(2-hydroxyethyl)-5,6-dimethylpyrido[4,3-b]carbazole-9-carboxamide |
| PubChem CID | 162755179 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | N-(2-hydroxyethyl)-5,6-dimethylpyrido[4,3-b]carbazole-9-carboxamide |
| SMILES | Cc1c2ccncc2cc2c3cc(C(=O)NCCO)ccc3n(C)c12 |
| InChI | InChI=1S/C20H19N3O2/c1-12-15-5-6-21-11-14(15)10-17-16-9-13(20(25)22-7-8-24)3-4-18(16)23(2)19(12)17/h3-6,9-11,24H,7-8H2,1-2H3,(H,22,25) |
| InChIKey | HMXJXCXSSYYKLH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-hydroxyethyl)-5,6-dimethylpyrido[4,3-b]carbazole-9-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxyethyl)-5,6-dimethylpyrido[4,3-b]carbazole-9-carboxamide?
The IUPAC name of N-(2-hydroxyethyl)-5,6-dimethylpyrido[4,3-b]carbazole-9-carboxamide (CID 162755179) is N-(2-hydroxyethyl)-5,6-dimethylpyrido[4,3-b]carbazole-9-carboxamide.
What is the SMILES notation for N-(2-hydroxyethyl)-5,6-dimethylpyrido[4,3-b]carbazole-9-carboxamide?
The canonical SMILES for N-(2-hydroxyethyl)-5,6-dimethylpyrido[4,3-b]carbazole-9-carboxamide is Cc1c2ccncc2cc2c3cc(C(=O)NCCO)ccc3n(C)c12.
What is the InChIKey of N-(2-hydroxyethyl)-5,6-dimethylpyrido[4,3-b]carbazole-9-carboxamide?
The InChIKey is HMXJXCXSSYYKLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O2/c1-12-15-5-6-21-11-14(15)10-17-16-9-13(20(25)22-7-8-24)3-4-18(16)23(2)19(12)17/h3-6,9-11,24H,7-8H2,1-2H3,(H,22,25).
What are the key properties of N-(2-hydroxyethyl)-5,6-dimethylpyrido[4,3-b]carbazole-9-carboxamide?
N-(2-hydroxyethyl)-5,6-dimethylpyrido[4,3-b]carbazole-9-carboxamide has a molecular weight of 333.39 g/mol, XLogP of 2.91, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxyethyl)-5,6-dimethylpyrido[4,3-b]carbazole-9-carboxamide is sourced from PubChem (CID 162755179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).