About 5-amino-3-bromo-1-(1,1,1-trifluoropropan-2-yl)pyrazole-4-carboxamide;ethane
5-amino-3-bromo-1-(1,1,1-trifluoropropan-2-yl)pyrazole-4-carboxamide;ethane (PubChem CID 162755929) has the molecular formula C9H14BrF3N4O
and a molecular weight of 331.14 g/mol. Its IUPAC name is 5-amino-3-bromo-1-(1,1,1-trifluoropropan-2-yl)pyrazole-4-carboxamide;ethane.
Molecular Properties
| Compound Name | 5-amino-3-bromo-1-(1,1,1-trifluoropropan-2-yl)pyrazole-4-carboxamide;ethane |
| PubChem CID | 162755929 |
| Molecular Formula | C9H14BrF3N4O |
| Molecular Weight | 331.14 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 5-amino-3-bromo-1-(1,1,1-trifluoropropan-2-yl)pyrazole-4-carboxamide;ethane |
| SMILES | CC.CC(n1nc(Br)c(C(N)=O)c1N)C(F)(F)F |
| InChI | InChI=1S/C7H8BrF3N4O.C2H6/c1-2(7(9,10)11)15-5(12)3(6(13)16)4(8)14-15;1-2/h2H,12H2,1H3,(H2,13,16);1-2H3 |
| InChIKey | MWHBRSKFYHWFDC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.14 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-amino-3-bromo-1-(1,1,1-trifluoropropan-2-yl)pyrazole-4-carboxamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-3-bromo-1-(1,1,1-trifluoropropan-2-yl)pyrazole-4-carboxamide;ethane?
The IUPAC name of 5-amino-3-bromo-1-(1,1,1-trifluoropropan-2-yl)pyrazole-4-carboxamide;ethane (CID 162755929) is 5-amino-3-bromo-1-(1,1,1-trifluoropropan-2-yl)pyrazole-4-carboxamide;ethane.
What is the SMILES notation for 5-amino-3-bromo-1-(1,1,1-trifluoropropan-2-yl)pyrazole-4-carboxamide;ethane?
The canonical SMILES for 5-amino-3-bromo-1-(1,1,1-trifluoropropan-2-yl)pyrazole-4-carboxamide;ethane is CC.CC(n1nc(Br)c(C(N)=O)c1N)C(F)(F)F.
What is the InChIKey of 5-amino-3-bromo-1-(1,1,1-trifluoropropan-2-yl)pyrazole-4-carboxamide;ethane?
The InChIKey is MWHBRSKFYHWFDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BrF3N4O.C2H6/c1-2(7(9,10)11)15-5(12)3(6(13)16)4(8)14-15;1-2/h2H,12H2,1H3,(H2,13,16);1-2H3.
What are the key properties of 5-amino-3-bromo-1-(1,1,1-trifluoropropan-2-yl)pyrazole-4-carboxamide;ethane?
5-amino-3-bromo-1-(1,1,1-trifluoropropan-2-yl)pyrazole-4-carboxamide;ethane has a molecular weight of 331.14 g/mol, XLogP of 2.48, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3-bromo-1-(1,1,1-trifluoropropan-2-yl)pyrazole-4-carboxamide;ethane is sourced from PubChem (CID 162755929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).