C25H25N3O5 — CID 162756349
3-[[6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanoyl]amino]-2-formamidopropanoic acid (PubChem CID 162756349) has the molecular formula C25H25N3O5 and a molecular weight of 447.49 g/mol. Its IUPAC name is 3-[[6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanoyl]amino]-2-formamidopropanoic acid.
| Compound Name | 3-[[6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanoyl]amino]-2-formamidopropanoic acid |
|---|---|
| PubChem CID | 162756349 |
| Molecular Formula | C25H25N3O5 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 3-[[6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanoyl]amino]-2-formamidopropanoic acid |
| SMILES | O=CNC(CNC(=O)CCCCC(=O)N1Cc2ccccc2C#Cc2ccccc21)C(=O)O |
| InChI | InChI=1S/C25H25N3O5/c29-17-27-21(25(32)33)15-26-23(30)11-5-6-12-24(31)28-16-20-9-2-1-7-18(20)13-14-19-8-3-4-10-22(19)28/h1-4,7-10,17,21H,5-6,11-12,15-16H2,(H,26,30)(H,27,29)(H,32,33) |
| InChIKey | FKMADELXOWUADQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|