C11H17NO6 — CID 162756458
2-[(E)-(2-methylpropan-2-yl)oxycarbonyliminomethyl]pentanedioic acid (PubChem CID 162756458) has the molecular formula C11H17NO6 and a molecular weight of 259.26 g/mol. Its IUPAC name is 2-[(E)-(2-methylpropan-2-yl)oxycarbonyliminomethyl]pentanedioic acid.
| Compound Name | 2-[(E)-(2-methylpropan-2-yl)oxycarbonyliminomethyl]pentanedioic acid |
|---|---|
| PubChem CID | 162756458 |
| Molecular Formula | C11H17NO6 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 2-[(E)-(2-methylpropan-2-yl)oxycarbonyliminomethyl]pentanedioic acid |
| SMILES | CC(C)(C)OC(=O)/N=C/C(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H17NO6/c1-11(2,3)18-10(17)12-6-7(9(15)16)4-5-8(13)14/h6-7H,4-5H2,1-3H3,(H,13,14)(H,15,16)/b12-6+ |
| InChIKey | ZKIRRJUYTARBNX-WUXMJOGZSA-N |
| XLogP | 1.56 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|