C15H18F3N3O5S — CID 162756735
5-[(3S)-3-(4,4-difluorobutylamino)-5-fluoro-7-hydroxy-3,4-dihydro-2H-chromen-6-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 162756735) has the molecular formula C15H18F3N3O5S and a molecular weight of 409.39 g/mol. Its IUPAC name is 5-[(3S)-3-(4,4-difluorobutylamino)-5-fluoro-7-hydroxy-3,4-dihydro-2H-chromen-6-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[(3S)-3-(4,4-difluorobutylamino)-5-fluoro-7-hydroxy-3,4-dihydro-2H-chromen-6-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 162756735 |
| Molecular Formula | C15H18F3N3O5S |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 5-[(3S)-3-(4,4-difluorobutylamino)-5-fluoro-7-hydroxy-3,4-dihydro-2H-chromen-6-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | O=C1CN(c2c(O)cc3c(c2F)C[C@H](NCCCC(F)F)CO3)S(=O)(=O)N1 |
| InChI | InChI=1S/C15H18F3N3O5S/c16-12(17)2-1-3-19-8-4-9-11(26-7-8)5-10(22)15(14(9)18)21-6-13(23)20-27(21,24)25/h5,8,12,19,22H,1-4,6-7H2,(H,20,23)/t8-/m0/s1 |
| InChIKey | MESAPVLWVXZMRR-QMMMGPOBSA-N |
| XLogP | 0.65 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|