C17H18FN3O4S2 — CID 162756765
5-[(7R)-1-fluoro-3-hydroxy-7-(thiophen-2-ylmethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 162756765) has the molecular formula C17H18FN3O4S2 and a molecular weight of 411.48 g/mol. Its IUPAC name is 5-[(7R)-1-fluoro-3-hydroxy-7-(thiophen-2-ylmethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[(7R)-1-fluoro-3-hydroxy-7-(thiophen-2-ylmethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 162756765 |
| Molecular Formula | C17H18FN3O4S2 |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 5-[(7R)-1-fluoro-3-hydroxy-7-(thiophen-2-ylmethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | O=C1CN(c2c(O)cc3c(c2F)C[C@H](NCc2cccs2)CC3)S(=O)(=O)N1 |
| InChI | InChI=1S/C17H18FN3O4S2/c18-16-13-7-11(19-8-12-2-1-5-26-12)4-3-10(13)6-14(22)17(16)21-9-15(23)20-27(21,24)25/h1-2,5-6,11,19,22H,3-4,7-9H2,(H,20,23)/t11-/m1/s1 |
| InChIKey | RPJSVPFRUSCPQC-LLVKDONJSA-N |
| XLogP | 1.42 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |