C17H20FN5O4S — CID 162756881
5-[(7R)-1-fluoro-3-hydroxy-7-[(3-methylimidazol-4-yl)methylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 162756881) has the molecular formula C17H20FN5O4S and a molecular weight of 409.44 g/mol. Its IUPAC name is 5-[(7R)-1-fluoro-3-hydroxy-7-[(3-methylimidazol-4-yl)methylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[(7R)-1-fluoro-3-hydroxy-7-[(3-methylimidazol-4-yl)methylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 162756881 |
| Molecular Formula | C17H20FN5O4S |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 5-[(7R)-1-fluoro-3-hydroxy-7-[(3-methylimidazol-4-yl)methylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | Cn1cncc1CN[C@@H]1CCc2cc(O)c(N3CC(=O)NS3(=O)=O)c(F)c2C1 |
| InChI | InChI=1S/C17H20FN5O4S/c1-22-9-19-6-12(22)7-20-11-3-2-10-4-14(24)17(16(18)13(10)5-11)23-8-15(25)21-28(23,26)27/h4,6,9,11,20,24H,2-3,5,7-8H2,1H3,(H,21,25)/t11-/m1/s1 |
| InChIKey | AFIVAIDLLGDNFM-LLVKDONJSA-N |
| XLogP | 0.09 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |