C22H26N2O6S2 — CID 162757030
4-[4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxymethyl]-4-methyl-1,3-thiazol-5-yl]-1,3-thiazol-2-yl]benzoic acid (PubChem CID 162757030) has the molecular formula C22H26N2O6S2 and a molecular weight of 478.59 g/mol. Its IUPAC name is 4-[4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxymethyl]-4-methyl-1,3-thiazol-5-yl]-1,3-thiazol-2-yl]benzoic acid.
| Compound Name | 4-[4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxymethyl]-4-methyl-1,3-thiazol-5-yl]-1,3-thiazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 162757030 |
| Molecular Formula | C22H26N2O6S2 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 4-[4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxymethyl]-4-methyl-1,3-thiazol-5-yl]-1,3-thiazol-2-yl]benzoic acid |
| SMILES | COCCOCCOCCOCc1nc(C)c(-c2csc(-c3ccc(C(=O)O)cc3)n2)s1 |
| InChI | InChI=1S/C22H26N2O6S2/c1-15-20(18-14-31-21(24-18)16-3-5-17(6-4-16)22(25)26)32-19(23-15)13-30-12-11-29-10-9-28-8-7-27-2/h3-6,14H,7-13H2,1-2H3,(H,25,26) |
| InChIKey | AHUSUYMMZPWLDS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 100.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|