About 4-[5-(2,4-dimethyl-1,3-thiazol-5-yl)-3-pyridinyl]-2-hydroxybenzoic acid
4-[5-(2,4-dimethyl-1,3-thiazol-5-yl)-3-pyridinyl]-2-hydroxybenzoic acid (PubChem CID 162757147) has the molecular formula C17H14N2O3S
and a molecular weight of 326.38 g/mol. Its IUPAC name is 4-[5-(2,4-dimethyl-1,3-thiazol-5-yl)-3-pyridinyl]-2-hydroxybenzoic acid.
Molecular Properties
| Compound Name | 4-[5-(2,4-dimethyl-1,3-thiazol-5-yl)-3-pyridinyl]-2-hydroxybenzoic acid |
| PubChem CID | 162757147 |
| Molecular Formula | C17H14N2O3S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 4-[5-(2,4-dimethyl-1,3-thiazol-5-yl)-3-pyridinyl]-2-hydroxybenzoic acid |
| SMILES | Cc1nc(C)c(-c2cncc(-c3ccc(C(=O)O)c(O)c3)c2)s1 |
| InChI | InChI=1S/C17H14N2O3S/c1-9-16(23-10(2)19-9)13-5-12(7-18-8-13)11-3-4-14(17(21)22)15(20)6-11/h3-8,20H,1-2H3,(H,21,22) |
| InChIKey | GEVUNCBOWIZTRG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[5-(2,4-dimethyl-1,3-thiazol-5-yl)-3-pyridinyl]-2-hydroxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(2,4-dimethyl-1,3-thiazol-5-yl)-3-pyridinyl]-2-hydroxybenzoic acid?
The IUPAC name of 4-[5-(2,4-dimethyl-1,3-thiazol-5-yl)-3-pyridinyl]-2-hydroxybenzoic acid (CID 162757147) is 4-[5-(2,4-dimethyl-1,3-thiazol-5-yl)-3-pyridinyl]-2-hydroxybenzoic acid.
What is the SMILES notation for 4-[5-(2,4-dimethyl-1,3-thiazol-5-yl)-3-pyridinyl]-2-hydroxybenzoic acid?
The canonical SMILES for 4-[5-(2,4-dimethyl-1,3-thiazol-5-yl)-3-pyridinyl]-2-hydroxybenzoic acid is Cc1nc(C)c(-c2cncc(-c3ccc(C(=O)O)c(O)c3)c2)s1.
What is the InChIKey of 4-[5-(2,4-dimethyl-1,3-thiazol-5-yl)-3-pyridinyl]-2-hydroxybenzoic acid?
The InChIKey is GEVUNCBOWIZTRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O3S/c1-9-16(23-10(2)19-9)13-5-12(7-18-8-13)11-3-4-14(17(21)22)15(20)6-11/h3-8,20H,1-2H3,(H,21,22).
What are the key properties of 4-[5-(2,4-dimethyl-1,3-thiazol-5-yl)-3-pyridinyl]-2-hydroxybenzoic acid?
4-[5-(2,4-dimethyl-1,3-thiazol-5-yl)-3-pyridinyl]-2-hydroxybenzoic acid has a molecular weight of 326.38 g/mol, XLogP of 3.89, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(2,4-dimethyl-1,3-thiazol-5-yl)-3-pyridinyl]-2-hydroxybenzoic acid is sourced from PubChem (CID 162757147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).