C17H13FN4O5S2 — CID 162757151
5-fluoro-2-hydroxy-4-[4-[4-methyl-2-[(oxamoylamino)methyl]-1,3-thiazol-5-yl]-1,3-thiazol-2-yl]benzoic acid (PubChem CID 162757151) has the molecular formula C17H13FN4O5S2 and a molecular weight of 436.45 g/mol. Its IUPAC name is 5-fluoro-2-hydroxy-4-[4-[4-methyl-2-[(oxamoylamino)methyl]-1,3-thiazol-5-yl]-1,3-thiazol-2-yl]benzoic acid.
| Compound Name | 5-fluoro-2-hydroxy-4-[4-[4-methyl-2-[(oxamoylamino)methyl]-1,3-thiazol-5-yl]-1,3-thiazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 162757151 |
| Molecular Formula | C17H13FN4O5S2 |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | 5-fluoro-2-hydroxy-4-[4-[4-methyl-2-[(oxamoylamino)methyl]-1,3-thiazol-5-yl]-1,3-thiazol-2-yl]benzoic acid |
| SMILES | Cc1nc(CNC(=O)C(N)=O)sc1-c1csc(-c2cc(O)c(C(=O)O)cc2F)n1 |
| InChI | InChI=1S/C17H13FN4O5S2/c1-6-13(29-12(21-6)4-20-15(25)14(19)24)10-5-28-16(22-10)7-3-11(23)8(17(26)27)2-9(7)18/h2-3,5,23H,4H2,1H3,(H2,19,24)(H,20,25)(H,26,27) |
| InChIKey | SLJOXZWRRVTVJC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 155.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|