About 4-[3-(2,4-dimethyl-1,3-thiazol-5-yl)phenyl]-2-(trifluoromethyl)benzoic acid
4-[3-(2,4-dimethyl-1,3-thiazol-5-yl)phenyl]-2-(trifluoromethyl)benzoic acid (PubChem CID 162757262) has the molecular formula C19H14F3NO2S
and a molecular weight of 377.39 g/mol. Its IUPAC name is 4-[3-(2,4-dimethyl-1,3-thiazol-5-yl)phenyl]-2-(trifluoromethyl)benzoic acid.
Molecular Properties
| Compound Name | 4-[3-(2,4-dimethyl-1,3-thiazol-5-yl)phenyl]-2-(trifluoromethyl)benzoic acid |
| PubChem CID | 162757262 |
| Molecular Formula | C19H14F3NO2S |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 4-[3-(2,4-dimethyl-1,3-thiazol-5-yl)phenyl]-2-(trifluoromethyl)benzoic acid |
| SMILES | Cc1nc(C)c(-c2cccc(-c3ccc(C(=O)O)c(C(F)(F)F)c3)c2)s1 |
| InChI | InChI=1S/C19H14F3NO2S/c1-10-17(26-11(2)23-10)14-5-3-4-12(8-14)13-6-7-15(18(24)25)16(9-13)19(20,21)22/h3-9H,1-2H3,(H,24,25) |
| InChIKey | ZXZMWOYWXDYTEH-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[3-(2,4-dimethyl-1,3-thiazol-5-yl)phenyl]-2-(trifluoromethyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(2,4-dimethyl-1,3-thiazol-5-yl)phenyl]-2-(trifluoromethyl)benzoic acid?
The IUPAC name of 4-[3-(2,4-dimethyl-1,3-thiazol-5-yl)phenyl]-2-(trifluoromethyl)benzoic acid (CID 162757262) is 4-[3-(2,4-dimethyl-1,3-thiazol-5-yl)phenyl]-2-(trifluoromethyl)benzoic acid.
What is the SMILES notation for 4-[3-(2,4-dimethyl-1,3-thiazol-5-yl)phenyl]-2-(trifluoromethyl)benzoic acid?
The canonical SMILES for 4-[3-(2,4-dimethyl-1,3-thiazol-5-yl)phenyl]-2-(trifluoromethyl)benzoic acid is Cc1nc(C)c(-c2cccc(-c3ccc(C(=O)O)c(C(F)(F)F)c3)c2)s1.
What is the InChIKey of 4-[3-(2,4-dimethyl-1,3-thiazol-5-yl)phenyl]-2-(trifluoromethyl)benzoic acid?
The InChIKey is ZXZMWOYWXDYTEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F3NO2S/c1-10-17(26-11(2)23-10)14-5-3-4-12(8-14)13-6-7-15(18(24)25)16(9-13)19(20,21)22/h3-9H,1-2H3,(H,24,25).
What are the key properties of 4-[3-(2,4-dimethyl-1,3-thiazol-5-yl)phenyl]-2-(trifluoromethyl)benzoic acid?
4-[3-(2,4-dimethyl-1,3-thiazol-5-yl)phenyl]-2-(trifluoromethyl)benzoic acid has a molecular weight of 377.39 g/mol, XLogP of 5.81, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(2,4-dimethyl-1,3-thiazol-5-yl)phenyl]-2-(trifluoromethyl)benzoic acid is sourced from PubChem (CID 162757262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).