C19H23FN6OS2 — CID 162757464
N-[[5-[2-(3-amino-5-fluoro-4-hydrazinylphenyl)-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-yl]methyl]-2,2-dimethylpropanamide (PubChem CID 162757464) has the molecular formula C19H23FN6OS2 and a molecular weight of 434.57 g/mol. Its IUPAC name is N-[[5-[2-(3-amino-5-fluoro-4-hydrazinylphenyl)-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-yl]methyl]-2,2-dimethylpropanamide.
| Compound Name | N-[[5-[2-(3-amino-5-fluoro-4-hydrazinylphenyl)-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-yl]methyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 162757464 |
| Molecular Formula | C19H23FN6OS2 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | N-[[5-[2-(3-amino-5-fluoro-4-hydrazinylphenyl)-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-yl]methyl]-2,2-dimethylpropanamide |
| SMILES | Cc1nc(CNC(=O)C(C)(C)C)sc1-c1csc(-c2cc(N)c(NN)c(F)c2)n1 |
| InChI | InChI=1S/C19H23FN6OS2/c1-9-16(29-14(24-9)7-23-18(27)19(2,3)4)13-8-28-17(25-13)10-5-11(20)15(26-22)12(21)6-10/h5-6,8,26H,7,21-22H2,1-4H3,(H,23,27) |
| InChIKey | OQLBQACMMAKSKD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|