C18H12F3N5OS2 — CID 162757489
2,3,6-trifluoro-4-[4-[4-methyl-2-[(pyridazin-3-ylamino)methyl]-1,3-thiazol-5-yl]-1,3-thiazol-2-yl]phenol (PubChem CID 162757489) has the molecular formula C18H12F3N5OS2 and a molecular weight of 435.46 g/mol. Its IUPAC name is 2,3,6-trifluoro-4-[4-[4-methyl-2-[(pyridazin-3-ylamino)methyl]-1,3-thiazol-5-yl]-1,3-thiazol-2-yl]phenol.
| Compound Name | 2,3,6-trifluoro-4-[4-[4-methyl-2-[(pyridazin-3-ylamino)methyl]-1,3-thiazol-5-yl]-1,3-thiazol-2-yl]phenol |
|---|---|
| PubChem CID | 162757489 |
| Molecular Formula | C18H12F3N5OS2 |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.04 |
| IUPAC Name | 2,3,6-trifluoro-4-[4-[4-methyl-2-[(pyridazin-3-ylamino)methyl]-1,3-thiazol-5-yl]-1,3-thiazol-2-yl]phenol |
| SMILES | Cc1nc(CNc2cccnn2)sc1-c1csc(-c2cc(F)c(O)c(F)c2F)n1 |
| InChI | InChI=1S/C18H12F3N5OS2/c1-8-17(29-13(24-8)6-22-12-3-2-4-23-26-12)11-7-28-18(25-11)9-5-10(19)16(27)15(21)14(9)20/h2-5,7,27H,6H2,1H3,(H,22,26) |
| InChIKey | ONMWWJWYCWFJQZ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|