C20H19F3N2O3S — CID 162757597
2,3,6-trifluoro-4-[6-[2-[(2-hydroxy-2-methylpropoxy)methyl]-4-methyl-1,3-thiazol-5-yl]-2-pyridinyl]phenol (PubChem CID 162757597) has the molecular formula C20H19F3N2O3S and a molecular weight of 424.44 g/mol. Its IUPAC name is 2,3,6-trifluoro-4-[6-[2-[(2-hydroxy-2-methylpropoxy)methyl]-4-methyl-1,3-thiazol-5-yl]-2-pyridinyl]phenol.
| Compound Name | 2,3,6-trifluoro-4-[6-[2-[(2-hydroxy-2-methylpropoxy)methyl]-4-methyl-1,3-thiazol-5-yl]-2-pyridinyl]phenol |
|---|---|
| PubChem CID | 162757597 |
| Molecular Formula | C20H19F3N2O3S |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 2,3,6-trifluoro-4-[6-[2-[(2-hydroxy-2-methylpropoxy)methyl]-4-methyl-1,3-thiazol-5-yl]-2-pyridinyl]phenol |
| SMILES | Cc1nc(COCC(C)(C)O)sc1-c1cccc(-c2cc(F)c(O)c(F)c2F)n1 |
| InChI | InChI=1S/C20H19F3N2O3S/c1-10-19(29-15(24-10)8-28-9-20(2,3)27)14-6-4-5-13(25-14)11-7-12(21)18(26)17(23)16(11)22/h4-7,26-27H,8-9H2,1-3H3 |
| InChIKey | PXYJVIZBMLSKKE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 75.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|