C20H18F2N8S — CID 162757665
N-[[5-[6-(4-amino-2,5-difluoro-3-hydrazinylphenyl)-2-pyridinyl]-4-methyl-1,3-thiazol-2-yl]methyl]pyrimidin-2-amine (PubChem CID 162757665) has the molecular formula C20H18F2N8S and a molecular weight of 440.48 g/mol. Its IUPAC name is N-[[5-[6-(4-amino-2,5-difluoro-3-hydrazinylphenyl)-2-pyridinyl]-4-methyl-1,3-thiazol-2-yl]methyl]pyrimidin-2-amine.
| Compound Name | N-[[5-[6-(4-amino-2,5-difluoro-3-hydrazinylphenyl)-2-pyridinyl]-4-methyl-1,3-thiazol-2-yl]methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 162757665 |
| Molecular Formula | C20H18F2N8S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | N-[[5-[6-(4-amino-2,5-difluoro-3-hydrazinylphenyl)-2-pyridinyl]-4-methyl-1,3-thiazol-2-yl]methyl]pyrimidin-2-amine |
| SMILES | Cc1nc(CNc2ncccn2)sc1-c1cccc(-c2cc(F)c(N)c(NN)c2F)n1 |
| InChI | InChI=1S/C20H18F2N8S/c1-10-19(31-15(28-10)9-27-20-25-6-3-7-26-20)14-5-2-4-13(29-14)11-8-12(21)17(23)18(30-24)16(11)22/h2-8,30H,9,23-24H2,1H3,(H,25,26,27) |
| InChIKey | NVGOEABUEXORQZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 127.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|