About methylphosphanylmethyl N-[2-(dimethylamino)ethyl]-N-methylcarbamate
methylphosphanylmethyl N-[2-(dimethylamino)ethyl]-N-methylcarbamate (PubChem CID 162757733) has the molecular formula C8H19N2O2P
and a molecular weight of 206.23 g/mol. Its IUPAC name is methylphosphanylmethyl N-[2-(dimethylamino)ethyl]-N-methylcarbamate.
Molecular Properties
| Compound Name | methylphosphanylmethyl N-[2-(dimethylamino)ethyl]-N-methylcarbamate |
| PubChem CID | 162757733 |
| Molecular Formula | C8H19N2O2P |
| Molecular Weight | 206.23 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | methylphosphanylmethyl N-[2-(dimethylamino)ethyl]-N-methylcarbamate |
| SMILES | CPCOC(=O)N(C)CCN(C)C |
| InChI | InChI=1S/C8H19N2O2P/c1-9(2)5-6-10(3)8(11)12-7-13-4/h13H,5-7H2,1-4H3 |
| InChIKey | YZRNZAWANAHYGJ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.23 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methylphosphanylmethyl N-[2-(dimethylamino)ethyl]-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylphosphanylmethyl N-[2-(dimethylamino)ethyl]-N-methylcarbamate?
The IUPAC name of methylphosphanylmethyl N-[2-(dimethylamino)ethyl]-N-methylcarbamate (CID 162757733) is methylphosphanylmethyl N-[2-(dimethylamino)ethyl]-N-methylcarbamate.
What is the SMILES notation for methylphosphanylmethyl N-[2-(dimethylamino)ethyl]-N-methylcarbamate?
The canonical SMILES for methylphosphanylmethyl N-[2-(dimethylamino)ethyl]-N-methylcarbamate is CPCOC(=O)N(C)CCN(C)C.
What is the InChIKey of methylphosphanylmethyl N-[2-(dimethylamino)ethyl]-N-methylcarbamate?
The InChIKey is YZRNZAWANAHYGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N2O2P/c1-9(2)5-6-10(3)8(11)12-7-13-4/h13H,5-7H2,1-4H3.
What are the key properties of methylphosphanylmethyl N-[2-(dimethylamino)ethyl]-N-methylcarbamate?
methylphosphanylmethyl N-[2-(dimethylamino)ethyl]-N-methylcarbamate has a molecular weight of 206.23 g/mol, XLogP of 0.88, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methylphosphanylmethyl N-[2-(dimethylamino)ethyl]-N-methylcarbamate is sourced from PubChem (CID 162757733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).