C7O7 — CID 162758542
cycloheptane-1,2,3,4,5,6,7-heptone (PubChem CID 162758542) has the molecular formula C7O7 and a molecular weight of 196.07 g/mol. Its IUPAC name is cycloheptane-1,2,3,4,5,6,7-heptone.
| Compound Name | cycloheptane-1,2,3,4,5,6,7-heptone |
|---|---|
| PubChem CID | 162758542 |
| Molecular Formula | C7O7 |
| Molecular Weight | 196.07 g/mol |
| Exact Mass | 195.96 |
| IUPAC Name | cycloheptane-1,2,3,4,5,6,7-heptone |
| SMILES | O=C1C(=O)C(=O)C(=O)C(=O)C(=O)C1=O |
| InChI | InChI=1S/C7O7/c8-1-2(9)4(11)6(13)7(14)5(12)3(1)10 |
| InChIKey | ZPVGWYUVJYNUIY-UHFFFAOYSA-N |
| XLogP | -3.02 |
| TPSA | 119.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.07 |
| LogP ≤ 5 | -3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|