C8O8 — CID 162758544
cyclooctane-1,2,3,4,5,6,7,8-octone (PubChem CID 162758544) has the molecular formula C8O8 and a molecular weight of 224.08 g/mol. Its IUPAC name is cyclooctane-1,2,3,4,5,6,7,8-octone.
| Compound Name | cyclooctane-1,2,3,4,5,6,7,8-octone |
|---|---|
| PubChem CID | 162758544 |
| Molecular Formula | C8O8 |
| Molecular Weight | 224.08 g/mol |
| Exact Mass | 223.96 |
| IUPAC Name | cyclooctane-1,2,3,4,5,6,7,8-octone |
| SMILES | O=C1C(=O)C(=O)C(=O)C(=O)C(=O)C(=O)C1=O |
| InChI | InChI=1S/C8O8/c9-1-2(10)4(12)6(14)8(16)7(15)5(13)3(1)11 |
| InChIKey | GXUMRHHUNQMBRZ-UHFFFAOYSA-N |
| XLogP | -3.45 |
| TPSA | 136.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.08 |
| LogP ≤ 5 | -3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|