C31H32N4O5 — CID 162758715
(2S)-N'-[bis(3-cyclopropylphenyl)methyl]-2-(8-methoxy-2,4-dioxopyrido[2,3-e][1,3]oxazin-3-yl)-N'-methylpropanehydrazide (PubChem CID 162758715) has the molecular formula C31H32N4O5 and a molecular weight of 540.62 g/mol. Its IUPAC name is (2S)-N'-[bis(3-cyclopropylphenyl)methyl]-2-(8-methoxy-2,4-dioxopyrido[2,3-e][1,3]oxazin-3-yl)-N'-methylpropanehydrazide.
| Compound Name | (2S)-N'-[bis(3-cyclopropylphenyl)methyl]-2-(8-methoxy-2,4-dioxopyrido[2,3-e][1,3]oxazin-3-yl)-N'-methylpropanehydrazide |
|---|---|
| PubChem CID | 162758715 |
| Molecular Formula | C31H32N4O5 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | (2S)-N'-[bis(3-cyclopropylphenyl)methyl]-2-(8-methoxy-2,4-dioxopyrido[2,3-e][1,3]oxazin-3-yl)-N'-methylpropanehydrazide |
| SMILES | COc1ccnc2c(=O)n([C@@H](C)C(=O)NN(C)C(c3cccc(C4CC4)c3)c3cccc(C4CC4)c3)c(=O)oc12 |
| InChI | InChI=1S/C31H32N4O5/c1-18(35-30(37)26-28(40-31(35)38)25(39-3)14-15-32-26)29(36)33-34(2)27(23-8-4-6-21(16-23)19-10-11-19)24-9-5-7-22(17-24)20-12-13-20/h4-9,14-20,27H,10-13H2,1-3H3,(H,33,36)/t18-/m0/s1 |
| InChIKey | UQHDIJFWHHFDHZ-SFHVURJKSA-N |
| XLogP | 4.43 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|