C18H21FN4O — CID 162759381
6-[(3E)-5-fluoro-4-methylhexa-1,3,5-trien-3-yl]-2-[2-(methylamino)ethylamino]imidazo[1,2-a]pyridine-3-carbaldehyde (PubChem CID 162759381) has the molecular formula C18H21FN4O and a molecular weight of 328.39 g/mol. Its IUPAC name is 6-[(3E)-5-fluoro-4-methylhexa-1,3,5-trien-3-yl]-2-[2-(methylamino)ethylamino]imidazo[1,2-a]pyridine-3-carbaldehyde.
| Compound Name | 6-[(3E)-5-fluoro-4-methylhexa-1,3,5-trien-3-yl]-2-[2-(methylamino)ethylamino]imidazo[1,2-a]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 162759381 |
| Molecular Formula | C18H21FN4O |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 6-[(3E)-5-fluoro-4-methylhexa-1,3,5-trien-3-yl]-2-[2-(methylamino)ethylamino]imidazo[1,2-a]pyridine-3-carbaldehyde |
| SMILES | C=C/C(=C(/C)C(=C)F)c1ccc2nc(NCCNC)c(C=O)n2c1 |
| InChI | InChI=1S/C18H21FN4O/c1-5-15(12(2)13(3)19)14-6-7-17-22-18(21-9-8-20-4)16(11-24)23(17)10-14/h5-7,10-11,20-21H,1,3,8-9H2,2,4H3/b15-12+ |
| InChIKey | PFMNVILAGJCTGC-NTCAYCPXSA-N |
| XLogP | 3.22 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|