About (2-amino-6-bromoimidazo[1,2-a]pyridin-3-yl)-[(1S,2S)-2-fluorocyclopropyl]methanone
(2-amino-6-bromoimidazo[1,2-a]pyridin-3-yl)-[(1S,2S)-2-fluorocyclopropyl]methanone (PubChem CID 162759595) has the molecular formula C11H9BrFN3O
and a molecular weight of 298.12 g/mol. Its IUPAC name is (2-amino-6-bromoimidazo[1,2-a]pyridin-3-yl)-[(1S,2S)-2-fluorocyclopropyl]methanone.
Molecular Properties
| Compound Name | (2-amino-6-bromoimidazo[1,2-a]pyridin-3-yl)-[(1S,2S)-2-fluorocyclopropyl]methanone |
| PubChem CID | 162759595 |
| Molecular Formula | C11H9BrFN3O |
| Molecular Weight | 298.12 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | (2-amino-6-bromoimidazo[1,2-a]pyridin-3-yl)-[(1S,2S)-2-fluorocyclopropyl]methanone |
| SMILES | Nc1nc2ccc(Br)cn2c1C(=O)[C@@H]1C[C@@H]1F |
| InChI | InChI=1S/C11H9BrFN3O/c12-5-1-2-8-15-11(14)9(16(8)4-5)10(17)6-3-7(6)13/h1-2,4,6-7H,3,14H2/t6-,7+/m1/s1 |
| InChIKey | MLOHDFYHFUPTDD-RQJHMYQMSA-N |
| XLogP | 2.22 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.12 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-amino-6-bromoimidazo[1,2-a]pyridin-3-yl)-[(1S,2S)-2-fluorocyclopropyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-6-bromoimidazo[1,2-a]pyridin-3-yl)-[(1S,2S)-2-fluorocyclopropyl]methanone?
The IUPAC name of (2-amino-6-bromoimidazo[1,2-a]pyridin-3-yl)-[(1S,2S)-2-fluorocyclopropyl]methanone (CID 162759595) is (2-amino-6-bromoimidazo[1,2-a]pyridin-3-yl)-[(1S,2S)-2-fluorocyclopropyl]methanone.
What is the SMILES notation for (2-amino-6-bromoimidazo[1,2-a]pyridin-3-yl)-[(1S,2S)-2-fluorocyclopropyl]methanone?
The canonical SMILES for (2-amino-6-bromoimidazo[1,2-a]pyridin-3-yl)-[(1S,2S)-2-fluorocyclopropyl]methanone is Nc1nc2ccc(Br)cn2c1C(=O)[C@@H]1C[C@@H]1F.
What is the InChIKey of (2-amino-6-bromoimidazo[1,2-a]pyridin-3-yl)-[(1S,2S)-2-fluorocyclopropyl]methanone?
The InChIKey is MLOHDFYHFUPTDD-RQJHMYQMSA-N. The full InChI is InChI=1S/C11H9BrFN3O/c12-5-1-2-8-15-11(14)9(16(8)4-5)10(17)6-3-7(6)13/h1-2,4,6-7H,3,14H2/t6-,7+/m1/s1.
What are the key properties of (2-amino-6-bromoimidazo[1,2-a]pyridin-3-yl)-[(1S,2S)-2-fluorocyclopropyl]methanone?
(2-amino-6-bromoimidazo[1,2-a]pyridin-3-yl)-[(1S,2S)-2-fluorocyclopropyl]methanone has a molecular weight of 298.12 g/mol, XLogP of 2.22, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-6-bromoimidazo[1,2-a]pyridin-3-yl)-[(1S,2S)-2-fluorocyclopropyl]methanone is sourced from PubChem (CID 162759595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).