C28H39N5O2S2 — CID 162759772
N-[3-(4-cyclopropylsulfonylpiperazin-1-yl)propyl]-5-[4-(diethylaminomethyl)phenyl]thieno[3,2-b]pyridin-7-amine (PubChem CID 162759772) has the molecular formula C28H39N5O2S2 and a molecular weight of 541.79 g/mol. Its IUPAC name is N-[3-(4-cyclopropylsulfonylpiperazin-1-yl)propyl]-5-[4-(diethylaminomethyl)phenyl]thieno[3,2-b]pyridin-7-amine.
| Compound Name | N-[3-(4-cyclopropylsulfonylpiperazin-1-yl)propyl]-5-[4-(diethylaminomethyl)phenyl]thieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 162759772 |
| Molecular Formula | C28H39N5O2S2 |
| Molecular Weight | 541.79 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | N-[3-(4-cyclopropylsulfonylpiperazin-1-yl)propyl]-5-[4-(diethylaminomethyl)phenyl]thieno[3,2-b]pyridin-7-amine |
| SMILES | CCN(CC)Cc1ccc(-c2cc(NCCCN3CCN(S(=O)(=O)C4CC4)CC3)c3sccc3n2)cc1 |
| InChI | InChI=1S/C28H39N5O2S2/c1-3-31(4-2)21-22-6-8-23(9-7-22)26-20-27(28-25(30-26)12-19-36-28)29-13-5-14-32-15-17-33(18-16-32)37(34,35)24-10-11-24/h6-9,12,19-20,24H,3-5,10-11,13-18,21H2,1-2H3,(H,29,30) |
| InChIKey | USCBOZOIBLTPAF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.79 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|