About 5-amino-N-(2,2-difluoroethyl)-1-methylpyrazole-3-carboxamide
5-amino-N-(2,2-difluoroethyl)-1-methylpyrazole-3-carboxamide (PubChem CID 162759828) has the molecular formula C7H10F2N4O
and a molecular weight of 204.18 g/mol. Its IUPAC name is 5-amino-N-(2,2-difluoroethyl)-1-methylpyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-amino-N-(2,2-difluoroethyl)-1-methylpyrazole-3-carboxamide |
| PubChem CID | 162759828 |
| Molecular Formula | C7H10F2N4O |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 5-amino-N-(2,2-difluoroethyl)-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1nc(C(=O)NCC(F)F)cc1N |
| InChI | InChI=1S/C7H10F2N4O/c1-13-6(10)2-4(12-13)7(14)11-3-5(8)9/h2,5H,3,10H2,1H3,(H,11,14) |
| InChIKey | AQQTUHYZZHKSME-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-amino-N-(2,2-difluoroethyl)-1-methylpyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N-(2,2-difluoroethyl)-1-methylpyrazole-3-carboxamide?
The IUPAC name of 5-amino-N-(2,2-difluoroethyl)-1-methylpyrazole-3-carboxamide (CID 162759828) is 5-amino-N-(2,2-difluoroethyl)-1-methylpyrazole-3-carboxamide.
What is the SMILES notation for 5-amino-N-(2,2-difluoroethyl)-1-methylpyrazole-3-carboxamide?
The canonical SMILES for 5-amino-N-(2,2-difluoroethyl)-1-methylpyrazole-3-carboxamide is Cn1nc(C(=O)NCC(F)F)cc1N.
What is the InChIKey of 5-amino-N-(2,2-difluoroethyl)-1-methylpyrazole-3-carboxamide?
The InChIKey is AQQTUHYZZHKSME-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F2N4O/c1-13-6(10)2-4(12-13)7(14)11-3-5(8)9/h2,5H,3,10H2,1H3,(H,11,14).
What are the key properties of 5-amino-N-(2,2-difluoroethyl)-1-methylpyrazole-3-carboxamide?
5-amino-N-(2,2-difluoroethyl)-1-methylpyrazole-3-carboxamide has a molecular weight of 204.18 g/mol, XLogP of -0.00, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N-(2,2-difluoroethyl)-1-methylpyrazole-3-carboxamide is sourced from PubChem (CID 162759828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).