About 2-(2,2-difluoroethylcarbamoyl)-4-methyl-1,3-thiazole-5-carboxylic acid
2-(2,2-difluoroethylcarbamoyl)-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 162759882) has the molecular formula C8H8F2N2O3S
and a molecular weight of 250.23 g/mol. Its IUPAC name is 2-(2,2-difluoroethylcarbamoyl)-4-methyl-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-(2,2-difluoroethylcarbamoyl)-4-methyl-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 162759882 |
| Molecular Formula | C8H8F2N2O3S |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 2-(2,2-difluoroethylcarbamoyl)-4-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1nc(C(=O)NCC(F)F)sc1C(=O)O |
| InChI | InChI=1S/C8H8F2N2O3S/c1-3-5(8(14)15)16-7(12-3)6(13)11-2-4(9)10/h4H,2H2,1H3,(H,11,13)(H,14,15) |
| InChIKey | XZNLHNYHXMMQAR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,2-difluoroethylcarbamoyl)-4-methyl-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-difluoroethylcarbamoyl)-4-methyl-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-(2,2-difluoroethylcarbamoyl)-4-methyl-1,3-thiazole-5-carboxylic acid (CID 162759882) is 2-(2,2-difluoroethylcarbamoyl)-4-methyl-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-(2,2-difluoroethylcarbamoyl)-4-methyl-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-(2,2-difluoroethylcarbamoyl)-4-methyl-1,3-thiazole-5-carboxylic acid is Cc1nc(C(=O)NCC(F)F)sc1C(=O)O.
What is the InChIKey of 2-(2,2-difluoroethylcarbamoyl)-4-methyl-1,3-thiazole-5-carboxylic acid?
The InChIKey is XZNLHNYHXMMQAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F2N2O3S/c1-3-5(8(14)15)16-7(12-3)6(13)11-2-4(9)10/h4H,2H2,1H3,(H,11,13)(H,14,15).
What are the key properties of 2-(2,2-difluoroethylcarbamoyl)-4-methyl-1,3-thiazole-5-carboxylic acid?
2-(2,2-difluoroethylcarbamoyl)-4-methyl-1,3-thiazole-5-carboxylic acid has a molecular weight of 250.23 g/mol, XLogP of 1.14, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-difluoroethylcarbamoyl)-4-methyl-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 162759882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).