C21H20F2N6O — CID 162760621
3-(5-fluoro-3,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-4-yl)-2-(5-fluoro-2-pyridinyl)-6,6-bis(trideuteriomethyl)-4,7-dihydropyrazolo[5,1-c][1,4]oxazine (PubChem CID 162760621) has the molecular formula C21H20F2N6O and a molecular weight of 416.46 g/mol. Its IUPAC name is 3-(5-fluoro-3,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-4-yl)-2-(5-fluoro-2-pyridinyl)-6,6-bis(trideuteriomethyl)-4,7-dihydropyrazolo[5,1-c][1,4]oxazine.
| Compound Name | 3-(5-fluoro-3,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-4-yl)-2-(5-fluoro-2-pyridinyl)-6,6-bis(trideuteriomethyl)-4,7-dihydropyrazolo[5,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 162760621 |
| Molecular Formula | C21H20F2N6O |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 3-(5-fluoro-3,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-4-yl)-2-(5-fluoro-2-pyridinyl)-6,6-bis(trideuteriomethyl)-4,7-dihydropyrazolo[5,1-c][1,4]oxazine |
| SMILES | [2H]C([2H])([2H])C1(C([2H])([2H])[2H])Cn2nc(-c3ccc(F)cn3)c(-c3c(F)c(C)nc4n[nH]c(C)c34)c2CO1 |
| InChI | InChI=1S/C21H20F2N6O/c1-10-15-17(18(23)11(2)25-20(15)27-26-10)16-14-8-30-21(3,4)9-29(14)28-19(16)13-6-5-12(22)7-24-13/h5-7H,8-9H2,1-4H3,(H,25,26,27)/i3D3,4D3 |
| InChIKey | YOONQHLDMHFGHX-LIJFRPJRSA-N |
| XLogP | 4.09 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |