About 3,3,3-trifluoro-2-(trideuteriomethyl)propane-1,2-diol
3,3,3-trifluoro-2-(trideuteriomethyl)propane-1,2-diol (PubChem CID 162760770) has the molecular formula C4H7F3O2
and a molecular weight of 147.11 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(trideuteriomethyl)propane-1,2-diol.
Analyze 3,3,3-trifluoro-2-(trideuteriomethyl)propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3,3-trifluoro-2-(trideuteriomethyl)propane-1,2-diol?
The IUPAC name of 3,3,3-trifluoro-2-(trideuteriomethyl)propane-1,2-diol (CID 162760770) is 3,3,3-trifluoro-2-(trideuteriomethyl)propane-1,2-diol.
What is the SMILES notation for 3,3,3-trifluoro-2-(trideuteriomethyl)propane-1,2-diol?
The canonical SMILES for 3,3,3-trifluoro-2-(trideuteriomethyl)propane-1,2-diol is [2H]C([2H])([2H])C(O)(CO)C(F)(F)F.
What is the InChIKey of 3,3,3-trifluoro-2-(trideuteriomethyl)propane-1,2-diol?
The InChIKey is HHCFIFZKQHBABN-FIBGUPNXSA-N. The full InChI is InChI=1S/C4H7F3O2/c1-3(9,2-8)4(5,6)7/h8-9H,2H2,1H3/i1D3.
What are the key properties of 3,3,3-trifluoro-2-(trideuteriomethyl)propane-1,2-diol?
3,3,3-trifluoro-2-(trideuteriomethyl)propane-1,2-diol has a molecular weight of 147.11 g/mol, XLogP of 0.29, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3,3-trifluoro-2-(trideuteriomethyl)propane-1,2-diol is sourced from PubChem (CID 162760770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).