About 4-[3-(5-fluoro-2-pyridinyl)-1-(2-methylpropyl)pyrazol-4-yl]-1H-pyrazolo[3,4-b]pyridine
4-[3-(5-fluoro-2-pyridinyl)-1-(2-methylpropyl)pyrazol-4-yl]-1H-pyrazolo[3,4-b]pyridine (PubChem CID 162760800) has the molecular formula C18H17FN6
and a molecular weight of 336.37 g/mol. Its IUPAC name is 4-[3-(5-fluoro-2-pyridinyl)-1-(2-methylpropyl)pyrazol-4-yl]-1H-pyrazolo[3,4-b]pyridine.
Molecular Properties
| Compound Name | 4-[3-(5-fluoro-2-pyridinyl)-1-(2-methylpropyl)pyrazol-4-yl]-1H-pyrazolo[3,4-b]pyridine |
| PubChem CID | 162760800 |
| Molecular Formula | C18H17FN6 |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 4-[3-(5-fluoro-2-pyridinyl)-1-(2-methylpropyl)pyrazol-4-yl]-1H-pyrazolo[3,4-b]pyridine |
| SMILES | CC(C)Cn1cc(-c2ccnc3[nH]ncc23)c(-c2ccc(F)cn2)n1 |
| InChI | InChI=1S/C18H17FN6/c1-11(2)9-25-10-15(13-5-6-20-18-14(13)8-22-23-18)17(24-25)16-4-3-12(19)7-21-16/h3-8,10-11H,9H2,1-2H3,(H,20,22,23) |
| InChIKey | CXLDXVLGWJSBNM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[3-(5-fluoro-2-pyridinyl)-1-(2-methylpropyl)pyrazol-4-yl]-1H-pyrazolo[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(5-fluoro-2-pyridinyl)-1-(2-methylpropyl)pyrazol-4-yl]-1H-pyrazolo[3,4-b]pyridine?
The IUPAC name of 4-[3-(5-fluoro-2-pyridinyl)-1-(2-methylpropyl)pyrazol-4-yl]-1H-pyrazolo[3,4-b]pyridine (CID 162760800) is 4-[3-(5-fluoro-2-pyridinyl)-1-(2-methylpropyl)pyrazol-4-yl]-1H-pyrazolo[3,4-b]pyridine.
What is the SMILES notation for 4-[3-(5-fluoro-2-pyridinyl)-1-(2-methylpropyl)pyrazol-4-yl]-1H-pyrazolo[3,4-b]pyridine?
The canonical SMILES for 4-[3-(5-fluoro-2-pyridinyl)-1-(2-methylpropyl)pyrazol-4-yl]-1H-pyrazolo[3,4-b]pyridine is CC(C)Cn1cc(-c2ccnc3[nH]ncc23)c(-c2ccc(F)cn2)n1.
What is the InChIKey of 4-[3-(5-fluoro-2-pyridinyl)-1-(2-methylpropyl)pyrazol-4-yl]-1H-pyrazolo[3,4-b]pyridine?
The InChIKey is CXLDXVLGWJSBNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17FN6/c1-11(2)9-25-10-15(13-5-6-20-18-14(13)8-22-23-18)17(24-25)16-4-3-12(19)7-21-16/h3-8,10-11H,9H2,1-2H3,(H,20,22,23).
What are the key properties of 4-[3-(5-fluoro-2-pyridinyl)-1-(2-methylpropyl)pyrazol-4-yl]-1H-pyrazolo[3,4-b]pyridine?
4-[3-(5-fluoro-2-pyridinyl)-1-(2-methylpropyl)pyrazol-4-yl]-1H-pyrazolo[3,4-b]pyridine has a molecular weight of 336.37 g/mol, XLogP of 3.68, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(5-fluoro-2-pyridinyl)-1-(2-methylpropyl)pyrazol-4-yl]-1H-pyrazolo[3,4-b]pyridine is sourced from PubChem (CID 162760800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).