About 8-[3-(5-fluoro-2-pyridinyl)-1-methylpyrazol-4-yl]-3-methoxy-1,5-naphthyridine
8-[3-(5-fluoro-2-pyridinyl)-1-methylpyrazol-4-yl]-3-methoxy-1,5-naphthyridine (PubChem CID 162760878) has the molecular formula C18H14FN5O
and a molecular weight of 335.34 g/mol. Its IUPAC name is 8-[3-(5-fluoro-2-pyridinyl)-1-methylpyrazol-4-yl]-3-methoxy-1,5-naphthyridine.
Molecular Properties
| Compound Name | 8-[3-(5-fluoro-2-pyridinyl)-1-methylpyrazol-4-yl]-3-methoxy-1,5-naphthyridine |
| PubChem CID | 162760878 |
| Molecular Formula | C18H14FN5O |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 8-[3-(5-fluoro-2-pyridinyl)-1-methylpyrazol-4-yl]-3-methoxy-1,5-naphthyridine |
| SMILES | COc1cnc2c(-c3cn(C)nc3-c3ccc(F)cn3)ccnc2c1 |
| InChI | InChI=1S/C18H14FN5O/c1-24-10-14(18(23-24)15-4-3-11(19)8-21-15)13-5-6-20-16-7-12(25-2)9-22-17(13)16/h3-10H,1-2H3 |
| InChIKey | DCKCXVKCFLCJGI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-[3-(5-fluoro-2-pyridinyl)-1-methylpyrazol-4-yl]-3-methoxy-1,5-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[3-(5-fluoro-2-pyridinyl)-1-methylpyrazol-4-yl]-3-methoxy-1,5-naphthyridine?
The IUPAC name of 8-[3-(5-fluoro-2-pyridinyl)-1-methylpyrazol-4-yl]-3-methoxy-1,5-naphthyridine (CID 162760878) is 8-[3-(5-fluoro-2-pyridinyl)-1-methylpyrazol-4-yl]-3-methoxy-1,5-naphthyridine.
What is the SMILES notation for 8-[3-(5-fluoro-2-pyridinyl)-1-methylpyrazol-4-yl]-3-methoxy-1,5-naphthyridine?
The canonical SMILES for 8-[3-(5-fluoro-2-pyridinyl)-1-methylpyrazol-4-yl]-3-methoxy-1,5-naphthyridine is COc1cnc2c(-c3cn(C)nc3-c3ccc(F)cn3)ccnc2c1.
What is the InChIKey of 8-[3-(5-fluoro-2-pyridinyl)-1-methylpyrazol-4-yl]-3-methoxy-1,5-naphthyridine?
The InChIKey is DCKCXVKCFLCJGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14FN5O/c1-24-10-14(18(23-24)15-4-3-11(19)8-21-15)13-5-6-20-16-7-12(25-2)9-22-17(13)16/h3-10H,1-2H3.
What are the key properties of 8-[3-(5-fluoro-2-pyridinyl)-1-methylpyrazol-4-yl]-3-methoxy-1,5-naphthyridine?
8-[3-(5-fluoro-2-pyridinyl)-1-methylpyrazol-4-yl]-3-methoxy-1,5-naphthyridine has a molecular weight of 335.34 g/mol, XLogP of 3.24, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[3-(5-fluoro-2-pyridinyl)-1-methylpyrazol-4-yl]-3-methoxy-1,5-naphthyridine is sourced from PubChem (CID 162760878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).