C16H20N2O6 — CID 162761122
5-hydroxy-2-[[4-[(5-hydroxy-4-oxopyran-2-yl)methylamino]butylamino]methyl]pyran-4-one (PubChem CID 162761122) has the molecular formula C16H20N2O6 and a molecular weight of 336.34 g/mol. Its IUPAC name is 5-hydroxy-2-[[4-[(5-hydroxy-4-oxopyran-2-yl)methylamino]butylamino]methyl]pyran-4-one.
| Compound Name | 5-hydroxy-2-[[4-[(5-hydroxy-4-oxopyran-2-yl)methylamino]butylamino]methyl]pyran-4-one |
|---|---|
| PubChem CID | 162761122 |
| Molecular Formula | C16H20N2O6 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 5-hydroxy-2-[[4-[(5-hydroxy-4-oxopyran-2-yl)methylamino]butylamino]methyl]pyran-4-one |
| SMILES | O=c1cc(CNCCCCNCc2cc(=O)c(O)co2)occ1O |
| InChI | InChI=1S/C16H20N2O6/c19-13-5-11(23-9-15(13)21)7-17-3-1-2-4-18-8-12-6-14(20)16(22)10-24-12/h5-6,9-10,17-18,21-22H,1-4,7-8H2 |
| InChIKey | REFHMYYQJKOROI-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 124.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|