C20H17N3O4S — CID 162761426
2-[(2S)-2-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-ylamino)-3-hydroxypropyl]isoindole-1,3-dione (PubChem CID 162761426) has the molecular formula C20H17N3O4S and a molecular weight of 395.44 g/mol. Its IUPAC name is 2-[(2S)-2-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-ylamino)-3-hydroxypropyl]isoindole-1,3-dione.
| Compound Name | 2-[(2S)-2-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-ylamino)-3-hydroxypropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 162761426 |
| Molecular Formula | C20H17N3O4S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 2-[(2S)-2-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-ylamino)-3-hydroxypropyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C[C@@H](CO)Nc1nc2c3c(ccc2s1)OCC3 |
| InChI | InChI=1S/C20H17N3O4S/c24-10-11(9-23-18(25)12-3-1-2-4-13(12)19(23)26)21-20-22-17-14-7-8-27-15(14)5-6-16(17)28-20/h1-6,11,24H,7-10H2,(H,21,22)/t11-/m0/s1 |
| InChIKey | CKEBRTMFYPLDPG-NSHDSACASA-N |
| XLogP | 2.30 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|