C18H20F2N4O2S — CID 162761466
(4S,5R)-5-[(3,3-difluoropyrrolidin-1-yl)methyl]-1-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-4-methylimidazolidin-2-one (PubChem CID 162761466) has the molecular formula C18H20F2N4O2S and a molecular weight of 394.45 g/mol. Its IUPAC name is (4S,5R)-5-[(3,3-difluoropyrrolidin-1-yl)methyl]-1-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-4-methylimidazolidin-2-one.
| Compound Name | (4S,5R)-5-[(3,3-difluoropyrrolidin-1-yl)methyl]-1-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-4-methylimidazolidin-2-one |
|---|---|
| PubChem CID | 162761466 |
| Molecular Formula | C18H20F2N4O2S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | (4S,5R)-5-[(3,3-difluoropyrrolidin-1-yl)methyl]-1-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-4-methylimidazolidin-2-one |
| SMILES | C[C@@H]1NC(=O)N(c2nc3c4c(ccc3s2)OCC4)[C@@H]1CN1CCC(F)(F)C1 |
| InChI | InChI=1S/C18H20F2N4O2S/c1-10-12(8-23-6-5-18(19,20)9-23)24(16(25)21-10)17-22-15-11-4-7-26-13(11)2-3-14(15)27-17/h2-3,10,12H,4-9H2,1H3,(H,21,25)/t10-,12+/m0/s1 |
| InChIKey | WDPUTTHIXIHPJW-CMPLNLGQSA-N |
| XLogP | 2.86 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |