C17H17F3N4O2S — CID 162761487
(3aR,7aS)-3-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-5-(2,2,2-trifluoroethyl)-1,3a,4,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-one (PubChem CID 162761487) has the molecular formula C17H17F3N4O2S and a molecular weight of 398.41 g/mol. Its IUPAC name is (3aR,7aS)-3-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-5-(2,2,2-trifluoroethyl)-1,3a,4,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-one.
| Compound Name | (3aR,7aS)-3-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-5-(2,2,2-trifluoroethyl)-1,3a,4,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 162761487 |
| Molecular Formula | C17H17F3N4O2S |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | (3aR,7aS)-3-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-5-(2,2,2-trifluoroethyl)-1,3a,4,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-one |
| SMILES | O=C1N[C@H]2CCN(CC(F)(F)F)C[C@H]2N1c1nc2c3c(ccc2s1)OCC3 |
| InChI | InChI=1S/C17H17F3N4O2S/c18-17(19,20)8-23-5-3-10-11(7-23)24(15(25)21-10)16-22-14-9-4-6-26-12(9)1-2-13(14)27-16/h1-2,10-11H,3-8H2,(H,21,25)/t10-,11+/m0/s1 |
| InChIKey | VGSUKLGLTQHGIQ-WDEREUQCSA-N |
| XLogP | 2.77 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |