C18H20N4O3S — CID 162761522
(3aS,7aS)-3-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-5-(oxetan-3-yl)-1,3a,4,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-one (PubChem CID 162761522) has the molecular formula C18H20N4O3S and a molecular weight of 372.45 g/mol. Its IUPAC name is (3aS,7aS)-3-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-5-(oxetan-3-yl)-1,3a,4,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-one.
| Compound Name | (3aS,7aS)-3-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-5-(oxetan-3-yl)-1,3a,4,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 162761522 |
| Molecular Formula | C18H20N4O3S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | (3aS,7aS)-3-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-5-(oxetan-3-yl)-1,3a,4,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-one |
| SMILES | O=C1N[C@H]2CCN(C3COC3)C[C@@H]2N1c1nc2c3c(ccc2s1)OCC3 |
| InChI | InChI=1S/C18H20N4O3S/c23-17-19-12-3-5-21(10-8-24-9-10)7-13(12)22(17)18-20-16-11-4-6-25-14(11)1-2-15(16)26-18/h1-2,10,12-13H,3-9H2,(H,19,23)/t12-,13-/m0/s1 |
| InChIKey | BMPIEALYEWVMLD-STQMWFEESA-N |
| XLogP | 1.60 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |