C15H14FN3O3S — CID 162761539
(3aR,7aR)-1-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-6-fluoro-3,3a,4,6,7,7a-hexahydropyrano[3,4-d]imidazol-2-one (PubChem CID 162761539) has the molecular formula C15H14FN3O3S and a molecular weight of 335.36 g/mol. Its IUPAC name is (3aR,7aR)-1-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-6-fluoro-3,3a,4,6,7,7a-hexahydropyrano[3,4-d]imidazol-2-one.
| Compound Name | (3aR,7aR)-1-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-6-fluoro-3,3a,4,6,7,7a-hexahydropyrano[3,4-d]imidazol-2-one |
|---|---|
| PubChem CID | 162761539 |
| Molecular Formula | C15H14FN3O3S |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | (3aR,7aR)-1-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-6-fluoro-3,3a,4,6,7,7a-hexahydropyrano[3,4-d]imidazol-2-one |
| SMILES | O=C1N[C@H]2COC(F)C[C@H]2N1c1nc2c3c(ccc2s1)OCC3 |
| InChI | InChI=1S/C15H14FN3O3S/c16-12-5-9-8(6-22-12)17-14(20)19(9)15-18-13-7-3-4-21-10(7)1-2-11(13)23-15/h1-2,8-9,12H,3-6H2,(H,17,20)/t8-,9+,12?/m0/s1 |
| InChIKey | CSHQJTIDMSFUGD-JIMHFIIXSA-N |
| XLogP | 2.21 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |