C16H21ClN4O2 — CID 162762055
(3Z,5E)-1-(4-amino-2-chloro-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)-6-methoxy-2-methylhepta-3,5-dien-1-one (PubChem CID 162762055) has the molecular formula C16H21ClN4O2 and a molecular weight of 336.82 g/mol. Its IUPAC name is (3Z,5E)-1-(4-amino-2-chloro-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)-6-methoxy-2-methylhepta-3,5-dien-1-one.
| Compound Name | (3Z,5E)-1-(4-amino-2-chloro-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)-6-methoxy-2-methylhepta-3,5-dien-1-one |
|---|---|
| PubChem CID | 162762055 |
| Molecular Formula | C16H21ClN4O2 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (3Z,5E)-1-(4-amino-2-chloro-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)-6-methoxy-2-methylhepta-3,5-dien-1-one |
| SMILES | CO/C(C)=C/C=C\C(C)C(=O)N1CCc2nc(Cl)nc(N)c2C1 |
| InChI | InChI=1S/C16H21ClN4O2/c1-10(5-4-6-11(2)23-3)15(22)21-8-7-13-12(9-21)14(18)20-16(17)19-13/h4-6,10H,7-9H2,1-3H3,(H2,18,19,20)/b5-4-,11-6+ |
| InChIKey | WFQYNVCOGQMGEW-UMEJXRAUSA-N |
| XLogP | 2.34 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|