About (3Z)-3-(1,1-difluoro-2-propoxyethyl)-4-fluoro-5-methylidenehepta-1,3-diene
(3Z)-3-(1,1-difluoro-2-propoxyethyl)-4-fluoro-5-methylidenehepta-1,3-diene (PubChem CID 162762112) has the molecular formula C13H19F3O
and a molecular weight of 248.29 g/mol. Its IUPAC name is (3Z)-3-(1,1-difluoro-2-propoxyethyl)-4-fluoro-5-methylidenehepta-1,3-diene.
Molecular Properties
| Compound Name | (3Z)-3-(1,1-difluoro-2-propoxyethyl)-4-fluoro-5-methylidenehepta-1,3-diene |
| PubChem CID | 162762112 |
| Molecular Formula | C13H19F3O |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (3Z)-3-(1,1-difluoro-2-propoxyethyl)-4-fluoro-5-methylidenehepta-1,3-diene |
| SMILES | C=C/C(=C(/F)C(=C)CC)C(F)(F)COCCC |
| InChI | InChI=1S/C13H19F3O/c1-5-8-17-9-13(15,16)11(7-3)12(14)10(4)6-2/h7H,3-6,8-9H2,1-2H3/b12-11- |
| InChIKey | JWAIQDAPCMUUEN-QXMHVHEDSA-N |
| XLogP | 4.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-(1,1-difluoro-2-propoxyethyl)-4-fluoro-5-methylidenehepta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-(1,1-difluoro-2-propoxyethyl)-4-fluoro-5-methylidenehepta-1,3-diene?
The IUPAC name of (3Z)-3-(1,1-difluoro-2-propoxyethyl)-4-fluoro-5-methylidenehepta-1,3-diene (CID 162762112) is (3Z)-3-(1,1-difluoro-2-propoxyethyl)-4-fluoro-5-methylidenehepta-1,3-diene.
What is the SMILES notation for (3Z)-3-(1,1-difluoro-2-propoxyethyl)-4-fluoro-5-methylidenehepta-1,3-diene?
The canonical SMILES for (3Z)-3-(1,1-difluoro-2-propoxyethyl)-4-fluoro-5-methylidenehepta-1,3-diene is C=C/C(=C(/F)C(=C)CC)C(F)(F)COCCC.
What is the InChIKey of (3Z)-3-(1,1-difluoro-2-propoxyethyl)-4-fluoro-5-methylidenehepta-1,3-diene?
The InChIKey is JWAIQDAPCMUUEN-QXMHVHEDSA-N. The full InChI is InChI=1S/C13H19F3O/c1-5-8-17-9-13(15,16)11(7-3)12(14)10(4)6-2/h7H,3-6,8-9H2,1-2H3/b12-11-.
What are the key properties of (3Z)-3-(1,1-difluoro-2-propoxyethyl)-4-fluoro-5-methylidenehepta-1,3-diene?
(3Z)-3-(1,1-difluoro-2-propoxyethyl)-4-fluoro-5-methylidenehepta-1,3-diene has a molecular weight of 248.29 g/mol, XLogP of 4.42, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-(1,1-difluoro-2-propoxyethyl)-4-fluoro-5-methylidenehepta-1,3-diene is sourced from PubChem (CID 162762112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).