About tert-butyl 3-formyl-3-prop-2-enylpyrrolidine-1-carboxylate;methoxymethane
tert-butyl 3-formyl-3-prop-2-enylpyrrolidine-1-carboxylate;methoxymethane (PubChem CID 162762164) has the molecular formula C15H27NO4
and a molecular weight of 285.38 g/mol. Its IUPAC name is tert-butyl 3-formyl-3-prop-2-enylpyrrolidine-1-carboxylate;methoxymethane.
Molecular Properties
| Compound Name | tert-butyl 3-formyl-3-prop-2-enylpyrrolidine-1-carboxylate;methoxymethane |
| PubChem CID | 162762164 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | tert-butyl 3-formyl-3-prop-2-enylpyrrolidine-1-carboxylate;methoxymethane |
| SMILES | C=CCC1(C=O)CCN(C(=O)OC(C)(C)C)C1.COC |
| InChI | InChI=1S/C13H21NO3.C2H6O/c1-5-6-13(10-15)7-8-14(9-13)11(16)17-12(2,3)4;1-3-2/h5,10H,1,6-9H2,2-4H3;1-2H3 |
| InChIKey | QRWARJHMNSOMRP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-formyl-3-prop-2-enylpyrrolidine-1-carboxylate;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-formyl-3-prop-2-enylpyrrolidine-1-carboxylate;methoxymethane?
The IUPAC name of tert-butyl 3-formyl-3-prop-2-enylpyrrolidine-1-carboxylate;methoxymethane (CID 162762164) is tert-butyl 3-formyl-3-prop-2-enylpyrrolidine-1-carboxylate;methoxymethane.
What is the SMILES notation for tert-butyl 3-formyl-3-prop-2-enylpyrrolidine-1-carboxylate;methoxymethane?
The canonical SMILES for tert-butyl 3-formyl-3-prop-2-enylpyrrolidine-1-carboxylate;methoxymethane is C=CCC1(C=O)CCN(C(=O)OC(C)(C)C)C1.COC.
What is the InChIKey of tert-butyl 3-formyl-3-prop-2-enylpyrrolidine-1-carboxylate;methoxymethane?
The InChIKey is QRWARJHMNSOMRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO3.C2H6O/c1-5-6-13(10-15)7-8-14(9-13)11(16)17-12(2,3)4;1-3-2/h5,10H,1,6-9H2,2-4H3;1-2H3.
What are the key properties of tert-butyl 3-formyl-3-prop-2-enylpyrrolidine-1-carboxylate;methoxymethane?
tert-butyl 3-formyl-3-prop-2-enylpyrrolidine-1-carboxylate;methoxymethane has a molecular weight of 285.38 g/mol, XLogP of 2.65, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-formyl-3-prop-2-enylpyrrolidine-1-carboxylate;methoxymethane is sourced from PubChem (CID 162762164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).