About 2-acetyl-N,N-dimethyl-2-azabicyclo[2.1.1]hexane-1-carboxamide
2-acetyl-N,N-dimethyl-2-azabicyclo[2.1.1]hexane-1-carboxamide (PubChem CID 162762226) has the molecular formula C10H16N2O2
and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-acetyl-N,N-dimethyl-2-azabicyclo[2.1.1]hexane-1-carboxamide.
Molecular Properties
| Compound Name | 2-acetyl-N,N-dimethyl-2-azabicyclo[2.1.1]hexane-1-carboxamide |
| PubChem CID | 162762226 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 2-acetyl-N,N-dimethyl-2-azabicyclo[2.1.1]hexane-1-carboxamide |
| SMILES | CC(=O)N1CC2CC1(C(=O)N(C)C)C2 |
| InChI | InChI=1S/C10H16N2O2/c1-7(13)12-6-8-4-10(12,5-8)9(14)11(2)3/h8H,4-6H2,1-3H3 |
| InChIKey | KTOFGYSVDVYYRG-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-acetyl-N,N-dimethyl-2-azabicyclo[2.1.1]hexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyl-N,N-dimethyl-2-azabicyclo[2.1.1]hexane-1-carboxamide?
The IUPAC name of 2-acetyl-N,N-dimethyl-2-azabicyclo[2.1.1]hexane-1-carboxamide (CID 162762226) is 2-acetyl-N,N-dimethyl-2-azabicyclo[2.1.1]hexane-1-carboxamide.
What is the SMILES notation for 2-acetyl-N,N-dimethyl-2-azabicyclo[2.1.1]hexane-1-carboxamide?
The canonical SMILES for 2-acetyl-N,N-dimethyl-2-azabicyclo[2.1.1]hexane-1-carboxamide is CC(=O)N1CC2CC1(C(=O)N(C)C)C2.
What is the InChIKey of 2-acetyl-N,N-dimethyl-2-azabicyclo[2.1.1]hexane-1-carboxamide?
The InChIKey is KTOFGYSVDVYYRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2/c1-7(13)12-6-8-4-10(12,5-8)9(14)11(2)3/h8H,4-6H2,1-3H3.
What are the key properties of 2-acetyl-N,N-dimethyl-2-azabicyclo[2.1.1]hexane-1-carboxamide?
2-acetyl-N,N-dimethyl-2-azabicyclo[2.1.1]hexane-1-carboxamide has a molecular weight of 196.25 g/mol, XLogP of 0.09, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyl-N,N-dimethyl-2-azabicyclo[2.1.1]hexane-1-carboxamide is sourced from PubChem (CID 162762226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).