About (2S,3S)-2-amino-3-(4-bromo-1,3-thiazol-2-yl)-3-ethoxypropanoic acid
(2S,3S)-2-amino-3-(4-bromo-1,3-thiazol-2-yl)-3-ethoxypropanoic acid (PubChem CID 162762635) has the molecular formula C8H11BrN2O3S
and a molecular weight of 295.16 g/mol. Its IUPAC name is (2S,3S)-2-amino-3-(4-bromo-1,3-thiazol-2-yl)-3-ethoxypropanoic acid.
Molecular Properties
| Compound Name | (2S,3S)-2-amino-3-(4-bromo-1,3-thiazol-2-yl)-3-ethoxypropanoic acid |
| PubChem CID | 162762635 |
| Molecular Formula | C8H11BrN2O3S |
| Molecular Weight | 295.16 g/mol |
| Exact Mass | 293.97 |
| IUPAC Name | (2S,3S)-2-amino-3-(4-bromo-1,3-thiazol-2-yl)-3-ethoxypropanoic acid |
| SMILES | CCO[C@H](c1nc(Br)cs1)[C@H](N)C(=O)O |
| InChI | InChI=1S/C8H11BrN2O3S/c1-2-14-6(5(10)8(12)13)7-11-4(9)3-15-7/h3,5-6H,2,10H2,1H3,(H,12,13)/t5-,6-/m0/s1 |
| InChIKey | OONSXEPMGGTTQH-WDSKDSINSA-N |
| XLogP | 1.40 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.16 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S,3S)-2-amino-3-(4-bromo-1,3-thiazol-2-yl)-3-ethoxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-2-amino-3-(4-bromo-1,3-thiazol-2-yl)-3-ethoxypropanoic acid?
The IUPAC name of (2S,3S)-2-amino-3-(4-bromo-1,3-thiazol-2-yl)-3-ethoxypropanoic acid (CID 162762635) is (2S,3S)-2-amino-3-(4-bromo-1,3-thiazol-2-yl)-3-ethoxypropanoic acid.
What is the SMILES notation for (2S,3S)-2-amino-3-(4-bromo-1,3-thiazol-2-yl)-3-ethoxypropanoic acid?
The canonical SMILES for (2S,3S)-2-amino-3-(4-bromo-1,3-thiazol-2-yl)-3-ethoxypropanoic acid is CCO[C@H](c1nc(Br)cs1)[C@H](N)C(=O)O.
What is the InChIKey of (2S,3S)-2-amino-3-(4-bromo-1,3-thiazol-2-yl)-3-ethoxypropanoic acid?
The InChIKey is OONSXEPMGGTTQH-WDSKDSINSA-N. The full InChI is InChI=1S/C8H11BrN2O3S/c1-2-14-6(5(10)8(12)13)7-11-4(9)3-15-7/h3,5-6H,2,10H2,1H3,(H,12,13)/t5-,6-/m0/s1.
What are the key properties of (2S,3S)-2-amino-3-(4-bromo-1,3-thiazol-2-yl)-3-ethoxypropanoic acid?
(2S,3S)-2-amino-3-(4-bromo-1,3-thiazol-2-yl)-3-ethoxypropanoic acid has a molecular weight of 295.16 g/mol, XLogP of 1.40, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2-amino-3-(4-bromo-1,3-thiazol-2-yl)-3-ethoxypropanoic acid is sourced from PubChem (CID 162762635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).