C28H34F3N5O4 — CID 162762721
methyl 3-[(3aS)-3a-[4-[[3-amino-5-(trifluoromethyl)phenyl]methylamino]-2-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carbonyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]furan-5-yl]propanoate (PubChem CID 162762721) has the molecular formula C28H34F3N5O4 and a molecular weight of 561.61 g/mol. Its IUPAC name is methyl 3-[(3aS)-3a-[4-[[3-amino-5-(trifluoromethyl)phenyl]methylamino]-2-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carbonyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]furan-5-yl]propanoate.
| Compound Name | methyl 3-[(3aS)-3a-[4-[[3-amino-5-(trifluoromethyl)phenyl]methylamino]-2-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carbonyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]furan-5-yl]propanoate |
|---|---|
| PubChem CID | 162762721 |
| Molecular Formula | C28H34F3N5O4 |
| Molecular Weight | 561.61 g/mol |
| Exact Mass | 561.26 |
| IUPAC Name | methyl 3-[(3aS)-3a-[4-[[3-amino-5-(trifluoromethyl)phenyl]methylamino]-2-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carbonyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]furan-5-yl]propanoate |
| SMILES | COC(=O)CCC1CC2COC[C@]2(C(=O)N2CCc3nc(C)nc(NCc4cc(N)cc(C(F)(F)F)c4)c3C2)C1 |
| InChI | InChI=1S/C28H34F3N5O4/c1-16-34-23-5-6-36(26(38)27-11-17(3-4-24(37)39-2)7-20(27)14-40-15-27)13-22(23)25(35-16)33-12-18-8-19(28(29,30)31)10-21(32)9-18/h8-10,17,20H,3-7,11-15,32H2,1-2H3,(H,33,34,35)/t17?,20?,27-/m1/s1 |
| InChIKey | XDYOFUFNSCYEAO-YVOXXEQWSA-N |
| XLogP | 3.88 |
| TPSA | 119.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.61 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|