C40H55N8O5SSi — CID 162763191
CID 162763191 (PubChem CID 162763191) has the molecular formula C40H55N8O5SSi and a molecular weight of 788.08 g/mol.
| Compound Name | CID 162763191 |
|---|---|
| PubChem CID | 162763191 |
| Molecular Formula | C40H55N8O5SSi |
| Molecular Weight | 788.08 g/mol |
| Exact Mass | 787.38 |
| IUPAC Name | — |
| SMILES | CCn1c2c3c4cc(ccc41)/C(N)=C/SC(C)C[C@H](NC(C)=O)C(=O)N1CCC[Si](N1)C(=O)OCC(C)(C)C3[C@H](OC)c1ncc(N3CCN(C)CC3)cc1-2 |
| InChI | InChI=1S/C40H55N8O5SSi/c1-8-47-32-11-10-26-19-28(32)33-34(37(52-7)35-29(36(33)47)20-27(21-42-35)46-15-13-45(6)14-16-46)40(4,5)23-53-39(51)55-17-9-12-48(44-55)38(50)31(43-25(3)49)18-24(2)54-22-30(26)41/h10-11,19-22,24,31,34,37,44H,8-9,12-18,23,41H2,1-7H3,(H,43,49)/b30-22-/t24?,31-,34?,37-/m0/s1 |
| InChIKey | SWNQSQFEKNRNFS-NKMRKISSSA-N |
| XLogP | 5.02 |
| TPSA | 147.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.08 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|