C22H20ClF4N3O3 — CID 162763673
6-chloro-N-[(1S,2R,4S)-2-fluoro-4-hydroxycyclohexyl]-8-[2-(2,2,2-trifluoroethoxy)phenyl]imidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 162763673) has the molecular formula C22H20ClF4N3O3 and a molecular weight of 485.87 g/mol. Its IUPAC name is 6-chloro-N-[(1S,2R,4S)-2-fluoro-4-hydroxycyclohexyl]-8-[2-(2,2,2-trifluoroethoxy)phenyl]imidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | 6-chloro-N-[(1S,2R,4S)-2-fluoro-4-hydroxycyclohexyl]-8-[2-(2,2,2-trifluoroethoxy)phenyl]imidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 162763673 |
| Molecular Formula | C22H20ClF4N3O3 |
| Molecular Weight | 485.87 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 6-chloro-N-[(1S,2R,4S)-2-fluoro-4-hydroxycyclohexyl]-8-[2-(2,2,2-trifluoroethoxy)phenyl]imidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | O=C(N[C@H]1CC[C@H](O)C[C@H]1F)c1cn2cc(Cl)cc(-c3ccccc3OCC(F)(F)F)c2n1 |
| InChI | InChI=1S/C22H20ClF4N3O3/c23-12-7-15(14-3-1-2-4-19(14)33-11-22(25,26)27)20-28-18(10-30(20)9-12)21(32)29-17-6-5-13(31)8-16(17)24/h1-4,7,9-10,13,16-17,31H,5-6,8,11H2,(H,29,32)/t13-,16+,17-/m0/s1 |
| InChIKey | NZRLPGHGAQOQFA-XKQJLSEDSA-N |
| XLogP | 4.58 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.87 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |