C24H24N4O3 — CID 162763935
N-[(2S)-1-[(3S)-3-hydroxypyrrolidin-1-yl]propan-2-yl]-11-oxo-12,18-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,13,15,17-octaene-16-carboxamide (PubChem CID 162763935) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is N-[(2S)-1-[(3S)-3-hydroxypyrrolidin-1-yl]propan-2-yl]-11-oxo-12,18-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,13,15,17-octaene-16-carboxamide.
| Compound Name | N-[(2S)-1-[(3S)-3-hydroxypyrrolidin-1-yl]propan-2-yl]-11-oxo-12,18-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,13,15,17-octaene-16-carboxamide |
|---|---|
| PubChem CID | 162763935 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | N-[(2S)-1-[(3S)-3-hydroxypyrrolidin-1-yl]propan-2-yl]-11-oxo-12,18-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,13,15,17-octaene-16-carboxamide |
| SMILES | C[C@@H](CN1CC[C@H](O)C1)NC(=O)c1cccn2c(=O)c3ccc4ccccc4c3nc12 |
| InChI | InChI=1S/C24H24N4O3/c1-15(13-27-12-10-17(29)14-27)25-23(30)20-7-4-11-28-22(20)26-21-18-6-3-2-5-16(18)8-9-19(21)24(28)31/h2-9,11,15,17,29H,10,12-14H2,1H3,(H,25,30)/t15-,17-/m0/s1 |
| InChIKey | CHXMOIOKJSWOEI-RDJZCZTQSA-N |
| XLogP | 2.19 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|