C8H11BrN2O2S — CID 162764131
2-amino-3-(4-bromo-1,3-thiazol-2-yl)-3-ethoxypropanal (PubChem CID 162764131) has the molecular formula C8H11BrN2O2S and a molecular weight of 279.16 g/mol. Its IUPAC name is 2-amino-3-(4-bromo-1,3-thiazol-2-yl)-3-ethoxypropanal.
| Compound Name | 2-amino-3-(4-bromo-1,3-thiazol-2-yl)-3-ethoxypropanal |
|---|---|
| PubChem CID | 162764131 |
| Molecular Formula | C8H11BrN2O2S |
| Molecular Weight | 279.16 g/mol |
| Exact Mass | 277.97 |
| IUPAC Name | 2-amino-3-(4-bromo-1,3-thiazol-2-yl)-3-ethoxypropanal |
| SMILES | CCOC(c1nc(Br)cs1)C(N)C=O |
| InChI | InChI=1S/C8H11BrN2O2S/c1-2-13-7(5(10)3-12)8-11-6(9)4-14-8/h3-5,7H,2,10H2,1H3 |
| InChIKey | WBOSEVZUSNZMFA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.16 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|