C31H36N4O2 — CID 162764627
4-[4-[(8R)-8-[(3R,5S,7S)-3,7-dimethyl-8-azatricyclo[5.2.1.03,9]decan-5-yl]-5,6,7,8-tetrahydrocinnolin-3-yl]-3-hydroxyphenyl]-1-methylpyridin-2-one (PubChem CID 162764627) has the molecular formula C31H36N4O2 and a molecular weight of 496.66 g/mol. Its IUPAC name is 4-[4-[(8R)-8-[(3R,5S,7S)-3,7-dimethyl-8-azatricyclo[5.2.1.03,9]decan-5-yl]-5,6,7,8-tetrahydrocinnolin-3-yl]-3-hydroxyphenyl]-1-methylpyridin-2-one.
| Compound Name | 4-[4-[(8R)-8-[(3R,5S,7S)-3,7-dimethyl-8-azatricyclo[5.2.1.03,9]decan-5-yl]-5,6,7,8-tetrahydrocinnolin-3-yl]-3-hydroxyphenyl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 162764627 |
| Molecular Formula | C31H36N4O2 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | 4-[4-[(8R)-8-[(3R,5S,7S)-3,7-dimethyl-8-azatricyclo[5.2.1.03,9]decan-5-yl]-5,6,7,8-tetrahydrocinnolin-3-yl]-3-hydroxyphenyl]-1-methylpyridin-2-one |
| SMILES | Cn1ccc(-c2ccc(-c3cc4c(nn3)[C@@H]([C@@H]3C[C@@]5(C)CC6C[C@@](C)(C3)C6N5)CCC4)c(O)c2)cc1=O |
| InChI | InChI=1S/C31H36N4O2/c1-30-14-21(16-31(2)17-22(15-30)29(30)32-31)23-6-4-5-20-11-25(33-34-28(20)23)24-8-7-18(12-26(24)36)19-9-10-35(3)27(37)13-19/h7-13,21-23,29,32,36H,4-6,14-17H2,1-3H3/t21-,22?,23+,29?,30+,31-/m0/s1 |
| InChIKey | YILAWCYSWNZVNH-XQELWGNSSA-N |
| XLogP | 5.19 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |