About CID 162764642
CID 162764642 (PubChem CID 162764642) has the molecular formula C25H25Cl2IN3O4S-
and a molecular weight of 661.37 g/mol.
Molecular Properties
| Compound Name | CID 162764642 |
| PubChem CID | 162764642 |
| Molecular Formula | C25H25Cl2IN3O4S- |
| Molecular Weight | 661.37 g/mol |
| Exact Mass | 660.00 |
| IUPAC Name | — |
| SMILES | CC(C)(c1ccc(OCC2=NC(NS(C)(=O)=O)=C[I-]C=C2)cc1)c1cc(Cl)c(OCCCl)c(C#N)c1 |
| InChI | InChI=1S/C25H25Cl2IN3O4S/c1-25(2,19-12-17(15-29)24(22(27)13-19)34-11-9-26)18-4-6-21(7-5-18)35-16-20-8-10-28-14-23(30-20)31-36(3,32)33/h4-8,10,12-14,31H,9,11,16H2,1-3H3/q-1 |
| InChIKey | YYTAAOWBBMBRHM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 661.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 162764642 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162764642?
The IUPAC name of CID 162764642 (CID 162764642) is not available.
What is the SMILES notation for CID 162764642?
The canonical SMILES for CID 162764642 is CC(C)(c1ccc(OCC2=NC(NS(C)(=O)=O)=C[I-]C=C2)cc1)c1cc(Cl)c(OCCCl)c(C#N)c1.
What is the InChIKey of CID 162764642?
The InChIKey is YYTAAOWBBMBRHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25Cl2IN3O4S/c1-25(2,19-12-17(15-29)24(22(27)13-19)34-11-9-26)18-4-6-21(7-5-18)35-16-20-8-10-28-14-23(30-20)31-36(3,32)33/h4-8,10,12-14,31H,9,11,16H2,1-3H3/q-1.
What are the key properties of CID 162764642?
CID 162764642 has a molecular weight of 661.37 g/mol, XLogP of 1.94, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162764642 is sourced from PubChem (CID 162764642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).