About CID 162764663
CID 162764663 (PubChem CID 162764663) has the molecular formula C23H34BN9O2
and a molecular weight of 479.40 g/mol.
Molecular Properties
| Compound Name | CID 162764663 |
| PubChem CID | 162764663 |
| Molecular Formula | C23H34BN9O2 |
| Molecular Weight | 479.40 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | — |
| SMILES | CNc1cc(NC)c2ncc(C(=O)NC3CCCC3)n2n1.[B]C(OC)c1ccc(N(C)N)c(N)c1 |
| InChI | InChI=1S/C14H20N6O.C9H14BN3O/c1-15-10-7-12(16-2)19-20-11(8-17-13(10)20)14(21)18-9-5-3-4-6-9;1-13(12)8-4-3-6(5-7(8)11)9(10)14-2/h7-9,15H,3-6H2,1-2H3,(H,16,19)(H,18,21);3-5,9H,11-12H2,1-2H3 |
| InChIKey | ONJNEVKWAOXCDS-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 147.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 479.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 162764663 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162764663?
The IUPAC name of CID 162764663 (CID 162764663) is not available.
What is the SMILES notation for CID 162764663?
The canonical SMILES for CID 162764663 is CNc1cc(NC)c2ncc(C(=O)NC3CCCC3)n2n1.[B]C(OC)c1ccc(N(C)N)c(N)c1.
What is the InChIKey of CID 162764663?
The InChIKey is ONJNEVKWAOXCDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N6O.C9H14BN3O/c1-15-10-7-12(16-2)19-20-11(8-17-13(10)20)14(21)18-9-5-3-4-6-9;1-13(12)8-4-3-6(5-7(8)11)9(10)14-2/h7-9,15H,3-6H2,1-2H3,(H,16,19)(H,18,21);3-5,9H,11-12H2,1-2H3.
What are the key properties of CID 162764663?
CID 162764663 has a molecular weight of 479.40 g/mol, XLogP of 1.88, 7 rotatable bonds, 5 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162764663 is sourced from PubChem (CID 162764663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).