C27H36N6O2 — CID 162765217
tert-butyl N-benzyl-N-[3-cyclopropyl-6-[[(3S)-1-methylpiperidin-3-yl]amino]imidazo[1,2-b]pyridazin-8-yl]carbamate (PubChem CID 162765217) has the molecular formula C27H36N6O2 and a molecular weight of 476.63 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[3-cyclopropyl-6-[[(3S)-1-methylpiperidin-3-yl]amino]imidazo[1,2-b]pyridazin-8-yl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[3-cyclopropyl-6-[[(3S)-1-methylpiperidin-3-yl]amino]imidazo[1,2-b]pyridazin-8-yl]carbamate |
|---|---|
| PubChem CID | 162765217 |
| Molecular Formula | C27H36N6O2 |
| Molecular Weight | 476.63 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | tert-butyl N-benzyl-N-[3-cyclopropyl-6-[[(3S)-1-methylpiperidin-3-yl]amino]imidazo[1,2-b]pyridazin-8-yl]carbamate |
| SMILES | CN1CCC[C@H](Nc2cc(N(Cc3ccccc3)C(=O)OC(C)(C)C)c3ncc(C4CC4)n3n2)C1 |
| InChI | InChI=1S/C27H36N6O2/c1-27(2,3)35-26(34)32(17-19-9-6-5-7-10-19)22-15-24(29-21-11-8-14-31(4)18-21)30-33-23(20-12-13-20)16-28-25(22)33/h5-7,9-10,15-16,20-21H,8,11-14,17-18H2,1-4H3,(H,29,30)/t21-/m0/s1 |
| InChIKey | PMAZXEZOPMIADN-NRFANRHFSA-N |
| XLogP | 5.05 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.63 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|