About (2R)-2-fluoro-2,3,5,6-tetrahydro-1H-pyrrolizine
(2R)-2-fluoro-2,3,5,6-tetrahydro-1H-pyrrolizine (PubChem CID 162765805) has the molecular formula C7H10FN
and a molecular weight of 127.16 g/mol. Its IUPAC name is (2R)-2-fluoro-2,3,5,6-tetrahydro-1H-pyrrolizine.
Analyze (2R)-2-fluoro-2,3,5,6-tetrahydro-1H-pyrrolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-fluoro-2,3,5,6-tetrahydro-1H-pyrrolizine?
The IUPAC name of (2R)-2-fluoro-2,3,5,6-tetrahydro-1H-pyrrolizine (CID 162765805) is (2R)-2-fluoro-2,3,5,6-tetrahydro-1H-pyrrolizine.
What is the SMILES notation for (2R)-2-fluoro-2,3,5,6-tetrahydro-1H-pyrrolizine?
The canonical SMILES for (2R)-2-fluoro-2,3,5,6-tetrahydro-1H-pyrrolizine is F[C@@H]1CC2=CCCN2C1.
What is the InChIKey of (2R)-2-fluoro-2,3,5,6-tetrahydro-1H-pyrrolizine?
The InChIKey is TYRHYPBOTCFWTL-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H10FN/c8-6-4-7-2-1-3-9(7)5-6/h2,6H,1,3-5H2/t6-/m1/s1.
What are the key properties of (2R)-2-fluoro-2,3,5,6-tetrahydro-1H-pyrrolizine?
(2R)-2-fluoro-2,3,5,6-tetrahydro-1H-pyrrolizine has a molecular weight of 127.16 g/mol, XLogP of 1.32, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-fluoro-2,3,5,6-tetrahydro-1H-pyrrolizine is sourced from PubChem (CID 162765805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).